ChemNet > CAS > 374897-99-1 1-(2,5-Dimethoxybenzyl)piperazine hydrochloride
374897-99-1 1-(2,5-Dimethoxybenzyl)piperazine hydrochloride
produktnavn |
1-(2,5-Dimethoxybenzyl)piperazine hydrochloride |
Synonymer |
1-(2,5-dimethoxybenzyl)piperazine |
Molekylær Formel |
C13H20N2O2 |
Molekylvekt |
236.3101 |
InChI |
InChI=1/C13H20N2O2/c1-16-12-3-4-13(17-2)11(9-12)10-15-7-5-14-6-8-15/h3-4,9,14H,5-8,10H2,1-2H3 |
CAS-nummer |
374897-99-1 |
Molecular Structure |
|
Tetthet |
1.074g/cm3 |
Kokepunkt |
351.1°C at 760 mmHg |
Brytningsindeks |
1.529 |
Flammepunktet |
166.2°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|